![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Acid-Base Theory.ppt | 2010-06-11 04:04 | 1.5M | |
| Alkenes.ppt | 2010-06-11 04:04 | 759K | |
| Balanced Equations.ppt | 2010-06-11 04:04 | 735K | |
| Bond and Lattice Enthalpies.ppt | 2010-06-11 04:04 | 3.1M | |
| Buffer Solutions.ppt | 2010-06-11 04:05 | 4.4M | |
| Calculating Relative Atomic Mass.ppt | 2010-06-11 04:05 | 451K | |
| Calorimetry.ppt | 2010-06-11 04:05 | 1.0M | |
| Catalysts.ppt | 2010-06-11 04:05 | 1.0M | |
| Collision Theory and Activation Energy.ppt | 2010-06-11 04:05 | 1.5M | |
| Concentration Moles and Volume.ppt | 2010-06-11 04:05 | 482K | |
| Covalent Structures.ppt | 2010-06-11 04:05 | 1.7M | |
| Dynamic Equilibria.ppt | 2010-06-11 04:05 | 546K | |
| Electron Configuration.ppt | 2010-06-11 04:05 | 741K | |
| Electronegativity.ppt | 2010-06-11 04:05 | 793K | |
| Energy Levels.ppt | 2010-06-11 04:06 | 843K | |
| Energy Sublevels.ppt | 2010-06-11 04:06 | 847K | |
| Enthalpy Change.ppt | 2010-06-11 04:06 | 964K | |
| Entropy.ppt | 2010-06-11 04:06 | 5.7M | |
| Equilibrium Constants.ppt | 2010-06-11 04:07 | 9.6M | |
| Equilibrium Constants for Acids and Bases.ppt | 2010-06-11 04:07 | 6.5M | |
| Evidence for the Nucleus.ppt | 2010-06-11 04:07 | 3.2M | |
| Fundamental Particles.ppt | 2010-06-11 04:07 | 514K | |
| Half Cells.ppt | 2010-06-11 04:07 | 3.3M | |
| Hesss Law.ppt | 2010-06-11 04:07 | 780K | |
| Ideal Gases.ppt | 2010-06-11 04:08 | 4.1M | |
| Intermolecular Forces.ppt | 2010-06-11 04:08 | 1.1M | |
| Interpreting Mass Spectra.ppt | 2010-06-11 04:08 | 1.3M | |
| Kinetic Molecular Theory.ppt | 2010-06-11 04:08 | 2.3M | |
| Kinetics Calculations and Experiments.ppt | 2010-06-11 04:08 | 2.9M | |
| Le Chateliers Principle.ppt | 2010-06-11 04:09 | 1.1M | |
| Mass Spectrometry.ppt | 2010-06-11 04:09 | 1.6M | |
| Moles.ppt | 2010-06-11 04:09 | 579K | |
| Nature of Bonding.ppt | 2010-06-11 04:09 | 1.8M | |
| Observing Line Spectra.ppt | 2010-06-11 04:09 | 4.1M | |
| Orbitals.ppt | 2010-06-11 04:09 | 1.3M | |
| Oxidation Numbers.ppt | 2010-06-11 04:10 | 715K | |
| Oxidation and Reduction.ppt | 2010-06-11 04:10 | 1.0M | |
| Period 3 Atomic Radii.ppt | 2010-06-11 04:10 | 1.0M | |
| Period 3 Ionization Energy.ppt | 2010-06-11 04:10 | 790K | |
| Period 3 Melting and Boiling Points.ppt | 2010-06-11 04:10 | 935K | |
| Period 3 Properties and Reactions.ppt | 2010-06-11 04:11 | 5.4M | |
| Predicting Redox Reactions.ppt | 2010-06-11 04:11 | 1.1M | |
| Radioactive Decay.ppt | 2010-06-11 04:11 | 2.4M | |
| Rate Equations.ppt | 2010-06-11 04:11 | 1.9M | |
| Rates of Reaction.ppt | 2010-06-11 04:11 | 2.5M | |
| Reacting Masses.ppt | 2010-06-11 04:12 | 650K | |
| Redox Reactions.ppt | 2010-06-11 04:12 | 1.9M | |
| Shapes of Molecules.ppt | 2010-06-11 04:12 | 1.3M | |
| Structural Isomerism.ppt | 2010-06-11 04:12 | 492K | |
| Thermal Energy.ppt | 2010-06-11 04:12 | 5.1M | |
| Types of Crystal.ppt | 2010-06-11 04:12 | 866K | |
| Types of Formulae.ppt | 2010-06-11 04:13 | 1.0M | |
| Types of Radiation.ppt | 2010-06-11 04:13 | 6.5M | |
|
|---|