![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | _template_worksheet.docx | 2016-10-20 11:25 | 56K | |
![[ ]](/icons/layout.gif) | Vaccination.pdf | 2016-10-20 11:25 | 446K | |
| Vaccination.docx | 2016-10-20 11:25 | 322K | |
| The Nitrogen Cycle Worksheet.doc | 2016-10-20 11:25 | 129K | |
| The Nervous System Worksheet.doc | 2016-10-20 11:25 | 162K | |
| The Movement of Water in Plants Worksheet.doc | 2016-10-20 11:25 | 556K | |
| The Eye and Seeing Worksheet.doc | 2016-10-20 11:25 | 157K | |
| The Circulatory System Worksheet.doc | 2016-10-20 11:25 | 405K | |
| The Carbon Cycle Worksheet.doc | 2016-10-20 11:25 | 216K | |
| The Brain and Learning Worksheet.doc | 2016-10-20 11:25 | 318K | |
| The Bodys Defences Worksheet.doc | 2016-10-20 11:25 | 133K | |
| Sustainability Worksheet.doc | 2016-10-20 11:25 | 245K | |
| Sustainability 2 Worksheet.doc | 2016-10-20 11:25 | 477K | |
| Sustainability 1 Worksheet.doc | 2016-10-20 11:25 | 240K | |
| Skeletal Systems Worksheet.doc | 2016-10-20 11:25 | 319K | |
| Similarity and Variation Worksheet.doc | 2016-10-20 11:25 | 272K | |
| Respiration and Circulation Worksheet.doc | 2016-10-20 11:25 | 313K | |
| Reflex Reactions Worksheet.doc | 2016-10-20 11:25 | 150K | |
| Plant Hormones Worksheet.doc | 2016-10-20 11:25 | 176K | |
| Photosynthesis Worksheet.doc | 2016-10-20 11:25 | 256K | |
| Organ Systems Worksheet.doc | 2016-10-20 11:25 | 359K | |
| Nutrients Worksheet.doc | 2016-10-20 11:25 | 210K | |
| Mutations.pdf | 2016-10-20 11:25 | 178K | |
| Mutations.docx | 2016-10-20 11:25 | 32K | |
| Mitosis Worksheet.doc | 2016-10-20 11:25 | 222K | |
| Meiosis and Stem Cells Worksheet.doc | 2016-10-20 11:25 | 242K | |
| Meiosis Worksheet.doc | 2016-10-20 11:25 | 233K | |
| Measuring Environmental Change Worksheet.doc | 2016-10-20 11:25 | 190K | |
| Life in Soil and Water Worksheet.doc | 2016-10-20 11:25 | 293K | |
| Investigating Ecosystems Worksheet.doc | 2016-10-20 11:25 | 267K | |
| Interdependence Worksheet.doc | 2016-10-20 11:25 | 461K | |
| Inherited Disorders Worksheet.doc | 2016-10-20 11:25 | 153K | |
| Inheritance Worksheet.doc | 2016-10-20 11:25 | 158K | |
| Inheritance.pdf | 2016-10-20 11:25 | 299K | |
| Inheritance.docx | 2016-10-20 11:25 | 64K | |
| Immunization Worksheet.doc | 2016-10-20 11:25 | 418K | |
| Human impact on the environment.pdf | 2016-10-20 11:25 | 372K | |
| Human impact on the environment.docx | 2016-10-20 11:25 | 85K | |
| Human Reproduction and Growth Worksheet.doc | 2016-10-20 11:25 | 292K | |
| Hormones and Fertility Worksheet.doc | 2016-10-20 11:25 | 206K | |
| Homeostasis Worksheet.doc | 2016-10-20 11:25 | 124K | |
| Heart Disease Worksheet.doc | 2016-10-20 11:25 | 202K | |
| Growth and Mitosis Worksheet.doc | 2016-10-20 11:25 | 264K | |
| Genetics Worksheet.doc | 2016-10-20 11:25 | 340K | |
| Genetic Engineering Worksheet.doc | 2016-10-20 11:25 | 121K | |
| Food Production Worksheet.doc | 2016-10-20 11:25 | 347K | |
| Experiment Rate of decay.pdf | 2016-10-20 11:25 | 236K | |
| Experiment Rate of decay.docx | 2016-10-20 11:25 | 37K | |
| Experiment Antibiotics and bacteria.pdf | 2016-10-20 11:25 | 221K | |
| Experiment Antibiotics and bacteria.docx | 2016-10-20 11:25 | 54K | |
| Excretion Worksheet.doc | 2016-10-20 11:25 | 202K | |
| Exchanging Materials Worksheet.doc | 2016-10-20 11:25 | 258K | |
| Enzymes.pdf | 2016-10-20 11:25 | 488K | |
| Enzymes.docx | 2016-10-20 11:25 | 400K | |
| Environmental Change and its Effects Worksheet.doc | 2016-10-20 11:25 | 642K | |
| Energy transfers in food chains.pdf | 2016-10-20 11:25 | 192K | |
| Energy transfers in food chains.docx | 2016-10-20 11:25 | 34K | |
| Drug development.pdf | 2016-10-20 11:25 | 245K | |
| Drug development.docx | 2016-10-20 11:25 | 33K | |
| Drug Use and Addiction Worksheet.doc | 2016-10-20 11:25 | 150K | |
| Disease Worksheet.doc | 2016-10-20 11:25 | 205K | |
| Digestion and Enzymes Worksheet.doc | 2016-10-20 11:25 | 292K | |
| Diffusion osmosis and active transport.pdf | 2016-10-20 11:25 | 401K | |
| Diffusion osmosis and active transport.docx | 2016-10-20 11:25 | 156K | |
| Diet Exercise and Health Worksheet.doc | 2016-10-20 11:25 | 222K | |
| DNA and protein synthesis.pdf | 2016-10-20 11:25 | 288K | |
| DNA and protein synthesis.docx | 2016-10-20 11:25 | 96K | |
| DNA Worksheet.doc | 2016-10-20 11:25 | 282K | |
| DNA.pdf | 2016-10-20 11:25 | 285K | |
| DNA.docx | 2016-10-20 11:25 | 163K | |
| Controlling Water Content Worksheet.doc | 2016-10-20 11:25 | 195K | |
| Controlling Blood Sugar Worksheet.doc | 2016-10-20 11:25 | 161K | |
| Competition Worksheet.doc | 2016-10-20 11:25 | 165K | |
| Cloning.pdf | 2016-10-20 11:25 | 233K | |
| Cloning.docx | 2016-10-20 11:25 | 77K | |
| Classifying Organisms Worksheet.doc | 2016-10-20 11:25 | 194K | |
| Cells Worksheet.doc | 2016-10-20 11:25 | 353K | |
| Causes of Disease Worksheet.doc | 2016-10-20 11:25 | 125K | |
| Breathing Worksheet.doc | 2016-10-20 11:25 | 270K | |
| Blood Pressure Worksheet.doc | 2016-10-20 11:25 | 255K | |
| Biofuels Worksheet.doc | 2016-10-20 11:25 | 302K | |
| Asexual reproduction.pdf | 2016-10-20 11:25 | 273K | |
| Asexual reproduction.docx | 2016-10-20 11:25 | 97K | |
| Alcohol and Tobacco Worksheet.doc | 2016-10-20 11:25 | 197K | |
| Adaptation Worksheet.doc | 2016-10-20 11:25 | 443K | |
|
|---|