![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Astronomical Distances.pptx | 2019-01-31 12:22 | 1.2M | |
| Biogeology.pptx | 2019-01-31 12:22 | 4.1M | |
| CFCs and the Environment.pptx | 2019-01-31 12:22 | 2.3M | |
| Carbon Footprints.pptx | 2019-01-31 12:22 | 3.5M | |
| Climate Change.pptx | 2019-01-31 12:22 | 2.7M | |
| Climate Systems.pptx | 2019-01-31 12:22 | 6.0M | |
| ENSO.pptx | 2019-01-31 12:23 | 1.8M | |
| Earthquakes.pptx | 2019-01-31 12:22 | 6.2M | |
| Earths Atmosphere.pptx | 2019-01-31 12:22 | 3.9M | |
| Extracting Metals by Alternative Methods.pptx | 2019-01-31 12:23 | 1.7M | |
| Feedback Systems.pptx | 2019-01-31 12:23 | 3.7M | |
| Fossils.pptx | 2019-01-31 12:23 | 3.5M | |
| History of Earth.pptx | 2019-01-31 12:23 | 1.8M | |
| Natural Hazards.pptx | 2019-01-31 12:23 | 4.6M | |
| Natural Resources.pptx | 2019-01-31 12:23 | 4.2M | |
| Origin of the Universe.pptx | 2019-01-31 12:23 | 3.1M | |
| Plate Tectonics.pptx | 2019-01-31 12:23 | 1.3M | |
| Pollution.pptx | 2019-01-31 12:23 | 2.7M | |
| Relief.pptx | 2019-01-31 12:23 | 2.5M | |
| Satellites.pptx | 2019-01-31 12:23 | 742K | |
| Seismic Waves.pptx | 2019-01-31 12:23 | 1.4M | |
| Solar Energy.pptx | 2019-01-31 12:23 | 1.2M | |
| Stars.pptx | 2019-01-31 12:23 | 4.7M | |
| Sustainable Use of Resources.pptx | 2019-01-31 12:23 | 1.8M | |
| Telescopes.pptx | 2019-01-31 12:23 | 556K | |
| The Earth and Moon.pptx | 2019-01-31 12:23 | 1.4M | |
| The Greenhouse Effect.pptx | 2019-01-31 12:23 | 2.3M | |
| The Rock Cycle.pptx | 2019-01-31 12:23 | 3.4M | |
| The Solar System.pptx | 2019-01-31 12:23 | 1.9M | |
| Understanding Earths Structure.pptx | 2019-01-31 12:23 | 1.5M | |
| Volcanoes.pptx | 2019-01-31 12:23 | 1.1M | |
| Water on Earth.pptx | 2019-01-31 12:24 | 3.5M | |
| Weather.pptx | 2019-01-31 12:24 | 4.7M | |
| Weathering.pptx | 2019-01-31 12:24 | 2.7M | |