![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Writing to Inform.doc | 2013-12-12 09:25 | 58K | |
| Writing to Argue.doc | 2013-12-12 09:25 | 54K | |
| Word Choice in Non Fiction.doc | 2013-12-12 09:25 | 50K | |
| Vocabulary.doc | 2013-12-12 09:25 | 54K | |
| Using Technology.doc | 2013-12-12 09:25 | 91K | |
| Themes in Literature.doc | 2013-12-12 09:25 | 72K | |
| Structure in Non Fiction.doc | 2013-12-12 09:25 | 68K | |
| Structure in Literature.doc | 2013-12-12 09:25 | 67K | |
| Speaking and Listening.doc | 2013-12-12 09:25 | 59K | |
| Research Skills.doc | 2013-12-12 09:25 | 66K | |
| Presenting.doc | 2013-12-12 09:25 | 61K | |
| Point of View in Non Fiction.doc | 2013-12-12 09:25 | 65K | |
| Point of View in Literature.doc | 2013-12-12 09:25 | 55K | |
| Plot Characters and Setting.doc | 2013-12-12 09:25 | 53K | |
| Media Literacy.doc | 2013-12-12 09:25 | 61K | |
| Literature in Production.doc | 2013-12-12 09:25 | 72K | |
| Language in Literature.doc | 2013-12-12 09:25 | 51K | |
| Creative Writing.doc | 2013-12-12 09:25 | 49K | |
| Comparing Non Fiction.doc | 2013-12-12 09:25 | 136K | |
| Comparing Literature.doc | 2013-12-12 09:25 | 68K | |
| Central Ideas in Non Fiction.doc | 2013-12-12 09:25 | 53K | |
| Assessing Arguments.doc | 2013-12-12 09:25 | 94K | |
| Analyzing Information.doc | 2013-12-12 09:25 | 58K | |
| Analyzing Elements in Non Fiction.doc | 2013-12-12 09:25 | 71K | |
|
|---|