![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Air Pollution.pdf | 2022-02-22 17:35 | 1.0M | |
| Astronomical Distances.pdf | 2022-02-22 17:35 | 609K | |
| Climate Change.pdf | 2022-02-22 17:35 | 660K | |
| Clouds.pdf | 2022-02-22 17:35 | 1.0M | |
| Coastal Depositional Landforms.pdf | 2022-02-22 17:36 | 475K | |
| Coastal Erosional Landforms.pdf | 2022-02-22 17:36 | 1.1M | |
| Coastal Processes.pdf | 2022-02-22 17:36 | 1.2M | |
| Conduction and Convection.pdf | 2022-02-22 17:36 | 1.2M | |
| Crude Oil.pdf | 2022-02-22 17:37 | 707K | |
| Doppler Effect.pdf | 2022-02-22 17:37 | 728K | |
| ENSO.pdf | 2022-02-22 17:38 | 1.0M | |
| Earthquake Causes.pdf | 2022-02-22 17:37 | 1.5M | |
| Earthquake Effects.pdf | 2022-02-22 17:37 | 1.7M | |
| Earths Structure.pdf | 2022-02-22 17:38 | 595K | |
| Erosion Transportation and Deposition.pdf | 2022-02-22 17:38 | 949K | |
| Evidence for climate change.pdf | 2022-02-22 17:38 | 914K | |
| Extinction.pdf | 2022-02-22 17:39 | 537K | |
| Extreme Flooding.pdf | 2022-02-22 17:39 | 380K | |
| Formation of Fossil Fuels.pdf | 2022-02-22 17:39 | 874K | |
| Fossil Fuels.pdf | 2022-02-22 17:39 | 840K | |
| Fossil Record.pdf | 2022-02-22 17:39 | 921K | |
| Gravity and Orbits.pdf | 2022-02-22 17:40 | 1.0M | |
| Greenhouse Gases.pdf | 2022-02-22 17:40 | 1.5M | |
| Heat Transfer and Global Interactions.pdf | 2022-02-22 17:40 | 1.6M | |
| Human Impact on the Environment.pdf | 2022-02-22 17:40 | 556K | |
| Hurricane Case Studies.pdf | 2022-02-22 17:41 | 1.0M | |
| Loss of Diversity.pdf | 2022-02-22 17:41 | 545K | |
| Managing Earthquakes.pdf | 2022-02-22 17:41 | 713K | |
| Measuring the Weather.pdf | 2022-02-22 17:41 | 1.6M | |
| Nuclear Fission.pdf | 2022-02-22 17:42 | 1.7M | |
| Nuclear Fusion.pdf | 2022-02-22 17:42 | 867K | |
| Observing the Universe.pdf | 2022-02-22 17:42 | 1.2M | |
| Planets of the Solar System.pdf | 2022-02-22 17:42 | 962K | |
| Plate Tectonics.pdf | 2022-02-22 17:43 | 1.4M | |
| Precipitation.pdf | 2022-02-22 17:43 | 876K | |
| Predicting Climate Change.pdf | 2022-02-22 17:43 | 413K | |
| Properties of Stars.pdf | 2022-02-22 17:43 | 1.3M | |
| Radioactive Dating.pdf | 2022-02-22 17:44 | 965K | |
| Recycling Nutrients.pdf | 2022-02-22 17:44 | 599K | |
| Relief.pdf | 2022-02-22 17:44 | 1.6M | |
| River Flooding.pdf | 2022-02-22 17:44 | 1.1M | |
| Satellites.pdf | 2022-02-22 17:45 | 654K | |
| Soil.pdf | 2022-02-22 17:45 | 472K | |
| Solar Energy.pdf | 2022-02-22 17:45 | 1.2M | |
| Structure of the Universe.pdf | 2022-02-22 17:45 | 1.0M | |
| Telescopes.pdf | 2022-02-22 17:45 | 487K | |
| The Atmosphere.pdf | 2022-02-22 17:46 | 466K | |
| The Carbon Cycle.pdf | 2022-02-22 17:46 | 1.0M | |
| The Impact of Mining.pdf | 2022-02-22 17:46 | 446K | |
| The Impact of Using CFCs.pdf | 2022-02-22 17:46 | 1.2M | |
| The Life Cycle of Stars.pdf | 2022-02-22 17:47 | 1.2M | |
| The Moon.pdf | 2022-02-22 17:47 | 1.3M | |
| The Nitrogen Cycle.pdf | 2022-02-22 17:47 | 837K | |
| The Rock Cycle.pdf | 2022-02-22 17:47 | 2.3M | |
| The Rotation of the Earth.pdf | 2022-02-22 17:48 | 623K | |
| The Water Cycle.pdf | 2022-02-22 17:48 | 442K | |
| Tropical Cyclones.pdf | 2022-02-22 17:48 | 917K | |
| Volcanoes.pdf | 2022-02-22 17:48 | 1.2M | |
| Water pollution.pdf | 2022-02-22 17:48 | 1.1M | |
| Weather and Climate.pdf | 2022-02-22 17:49 | 1.8M | |
| Weathering.pdf | 2022-02-22 17:49 | 1.6M | |
|
|---|