![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Comparing Non Fiction.pdf | 2022-02-24 08:29 | 500K | |
| Central Ideas in Non Fiction.pdf | 2022-02-24 08:29 | 530K | |
| Point of View in Non Fiction.pdf | 2022-02-24 08:31 | 633K | |
| Media Literacy.pdf | 2022-02-24 08:30 | 655K | |
| Point of View in Literature.pdf | 2022-02-24 08:31 | 789K | |
| Assessing Arguments.pdf | 2022-02-24 08:29 | 796K | |
| Word Choice in Non Fiction.pdf | 2022-02-24 08:33 | 803K | |
| Research Skills.pdf | 2022-02-24 08:31 | 826K | |
| Comparing Literature.pdf | 2022-02-24 08:29 | 879K | |
| Literature in Production.pdf | 2022-02-24 08:30 | 903K | |
| Language in Literature.pdf | 2022-02-24 08:30 | 908K | |
| Analyzing Elements in Non Fiction.pdf | 2022-02-24 08:28 | 932K | |
| Structure in Non Fiction.pdf | 2022-02-24 08:32 | 1.0M | |
| Writing to Inform.pdf | 2022-02-24 08:33 | 1.1M | |
| Using Technology.pdf | 2022-02-24 08:32 | 1.1M | |
| Vocabulary.pdf | 2022-02-24 08:33 | 1.1M | |
| Plot Characters and Setting.pdf | 2022-02-24 08:30 | 1.2M | |
| Writing to Argue.pdf | 2022-02-24 08:33 | 1.3M | |
| Structure in Literature.pdf | 2022-02-24 08:32 | 1.4M | |
| Speaking and Listening.pdf | 2022-02-24 08:32 | 1.4M | |
| Presenting.pdf | 2022-02-24 08:31 | 1.4M | |
| Themes in Literature.pdf | 2022-02-24 08:32 | 2.0M | |
| Analyzing Information.pdf | 2022-02-24 08:29 | 2.1M | |
| Creative Writing.pdf | 2022-02-24 08:30 | 2.2M | |
|
|---|