![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Narrative Structure.pdf | 2022-02-22 17:52 | 767K | |
![[ ]](/icons/layout.gif) | Analyzing Informational Texts 2.pdf | 2022-02-22 17:50 | 785K | |
![[ ]](/icons/layout.gif) | Vocabulary.pdf | 2022-02-22 17:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Comparative Literature 2.pdf | 2022-02-22 17:51 | 1.2M | |
![[ ]](/icons/layout.gif) | Critical Reading.pdf | 2022-02-22 17:51 | 1.2M | |
![[ ]](/icons/layout.gif) | Characterization.pdf | 2022-02-22 17:50 | 1.2M | |
![[ ]](/icons/layout.gif) | Practicing Creative Writing.pdf | 2022-02-22 17:53 | 1.2M | |
![[ ]](/icons/layout.gif) | Comparative Literature 1.pdf | 2022-02-22 17:51 | 1.2M | |
![[ ]](/icons/layout.gif) | Non Fiction Craft and Structure 1.pdf | 2022-02-22 17:52 | 1.2M | |
![[ ]](/icons/layout.gif) | Textual Analysis and Using Evidence.pdf | 2022-02-22 17:54 | 1.3M | |
![[ ]](/icons/layout.gif) | Analyzing Historical Documents.pdf | 2022-02-22 17:49 | 1.3M | |
![[ ]](/icons/layout.gif) | Language in Literature.pdf | 2022-02-22 17:52 | 1.4M | |
![[ ]](/icons/layout.gif) | Analyzing Informational Texts 1.pdf | 2022-02-22 17:50 | 1.4M | |
![[ ]](/icons/layout.gif) | Collaborative Writing.pdf | 2022-02-22 17:50 | 1.4M | |
![[ ]](/icons/layout.gif) | Writing to Inform.pdf | 2022-02-22 17:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Introducing Creative Writing.pdf | 2022-02-22 17:51 | 1.5M | |
![[ ]](/icons/layout.gif) | Non Fiction Craft and Structure 2.pdf | 2022-02-22 17:52 | 1.5M | |
![[ ]](/icons/layout.gif) | Research Projects.pdf | 2022-02-22 17:53 | 1.5M | |
![[ ]](/icons/layout.gif) | Themes and Ideas.pdf | 2022-02-22 17:54 | 1.6M | |
![[ ]](/icons/layout.gif) | Point of View.pdf | 2022-02-22 17:52 | 1.7M | |
![[ ]](/icons/layout.gif) | Writing to Argue.pdf | 2022-02-22 17:54 | 1.8M | |
![[ ]](/icons/layout.gif) | Speaking and Listening.pdf | 2022-02-22 17:53 | 2.0M | |
![[ ]](/icons/layout.gif) | Presenting.pdf | 2022-02-22 17:53 | 2.1M | |
|