![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Narrative Structure.pdf | 2022-02-22 17:52 | 767K | |
| Analyzing Informational Texts 2.pdf | 2022-02-22 17:50 | 785K | |
| Vocabulary.pdf | 2022-02-22 17:54 | 1.1M | |
| Comparative Literature 2.pdf | 2022-02-22 17:51 | 1.2M | |
| Critical Reading.pdf | 2022-02-22 17:51 | 1.2M | |
| Characterization.pdf | 2022-02-22 17:50 | 1.2M | |
| Practicing Creative Writing.pdf | 2022-02-22 17:53 | 1.2M | |
| Comparative Literature 1.pdf | 2022-02-22 17:51 | 1.2M | |
| Non Fiction Craft and Structure 1.pdf | 2022-02-22 17:52 | 1.2M | |
| Textual Analysis and Using Evidence.pdf | 2022-02-22 17:54 | 1.3M | |
| Analyzing Historical Documents.pdf | 2022-02-22 17:49 | 1.3M | |
| Language in Literature.pdf | 2022-02-22 17:52 | 1.4M | |
| Analyzing Informational Texts 1.pdf | 2022-02-22 17:50 | 1.4M | |
| Collaborative Writing.pdf | 2022-02-22 17:50 | 1.4M | |
| Writing to Inform.pdf | 2022-02-22 17:55 | 1.4M | |
| Introducing Creative Writing.pdf | 2022-02-22 17:51 | 1.5M | |
| Non Fiction Craft and Structure 2.pdf | 2022-02-22 17:52 | 1.5M | |
| Research Projects.pdf | 2022-02-22 17:53 | 1.5M | |
| Themes and Ideas.pdf | 2022-02-22 17:54 | 1.6M | |
| Point of View.pdf | 2022-02-22 17:52 | 1.7M | |
| Writing to Argue.pdf | 2022-02-22 17:54 | 1.8M | |
| Speaking and Listening.pdf | 2022-02-22 17:53 | 2.0M | |
| Presenting.pdf | 2022-02-22 17:53 | 2.1M | |
|
|---|